C28H26ClN7O11 — CID 15289345
2-(2-chloro-6-nitrophenyl)ethyl [(2R,3S,5R)-3-hydroxy-5-[6-[2-(4-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-2-yl]methyl carbonate (PubChem CID 15289345) has the molecular formula C28H26ClN7O11 and a molecular weight of 672.01 g/mol. Its IUPAC name is 2-(2-chloro-6-nitrophenyl)ethyl [(2R,3S,5R)-3-hydroxy-5-[6-[2-(4-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-2-yl]methyl carbonate.
| Compound Name | 2-(2-chloro-6-nitrophenyl)ethyl [(2R,3S,5R)-3-hydroxy-5-[6-[2-(4-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 15289345 |
| Molecular Formula | C28H26ClN7O11 |
| Molecular Weight | 672.01 g/mol |
| Exact Mass | 671.14 |
| IUPAC Name | 2-(2-chloro-6-nitrophenyl)ethyl [(2R,3S,5R)-3-hydroxy-5-[6-[2-(4-nitrophenyl)ethoxycarbonylamino]purin-9-yl]oxolan-2-yl]methyl carbonate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COC(=O)OCCc2c(Cl)cccc2[N+](=O)[O-])O1)OCCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H26ClN7O11/c29-19-2-1-3-20(36(42)43)18(19)9-11-45-28(39)46-13-22-21(37)12-23(47-22)34-15-32-24-25(30-14-31-26(24)34)33-27(38)44-10-8-16-4-6-17(7-5-16)35(40)41/h1-7,14-15,21-23,37H,8-13H2,(H,30,31,33,38)/t21-,22+,23+/m0/s1 |
| InChIKey | RRJAKEKWNFMEFW-YTFSRNRJSA-N |
| XLogP | 4.13 |
| TPSA | 233.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.01 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|