C19H19N5O9 — CID 58827434
[5-[6-(ethenoxycarbonylamino)purin-9-yl]-2-(ethenoxycarbonyloxymethyl)oxolan-3-yl] ethenyl carbonate (PubChem CID 58827434) has the molecular formula C19H19N5O9 and a molecular weight of 461.39 g/mol. Its IUPAC name is [5-[6-(ethenoxycarbonylamino)purin-9-yl]-2-(ethenoxycarbonyloxymethyl)oxolan-3-yl] ethenyl carbonate.
| Compound Name | [5-[6-(ethenoxycarbonylamino)purin-9-yl]-2-(ethenoxycarbonyloxymethyl)oxolan-3-yl] ethenyl carbonate |
|---|---|
| PubChem CID | 58827434 |
| Molecular Formula | C19H19N5O9 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [5-[6-(ethenoxycarbonylamino)purin-9-yl]-2-(ethenoxycarbonyloxymethyl)oxolan-3-yl] ethenyl carbonate |
| SMILES | C=COC(=O)Nc1ncnc2c1ncn2C1CC(OC(=O)OC=C)C(COC(=O)OC=C)O1 |
| InChI | InChI=1S/C19H19N5O9/c1-4-28-17(25)23-15-14-16(21-9-20-15)24(10-22-14)13-7-11(33-19(27)30-6-3)12(32-13)8-31-18(26)29-5-2/h4-6,9-13H,1-3,7-8H2,(H,20,21,23,25) |
| InChIKey | OSTVMNZUXFHSRW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|