C20H22N6O8 — CID 15333736
2-(4-nitrophenyl)ethyl N-[9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]purin-6-yl]carbamate (PubChem CID 15333736) has the molecular formula C20H22N6O8 and a molecular weight of 474.43 g/mol. Its IUPAC name is 2-(4-nitrophenyl)ethyl N-[9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]purin-6-yl]carbamate.
| Compound Name | 2-(4-nitrophenyl)ethyl N-[9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 15333736 |
| Molecular Formula | C20H22N6O8 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-(4-nitrophenyl)ethyl N-[9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]purin-6-yl]carbamate |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(NC(=O)OCCc3ccc([N+](=O)[O-])cc3)ncnc21 |
| InChI | InChI=1S/C20H22N6O8/c1-32-16-15(28)13(8-27)34-19(16)25-10-23-14-17(21-9-22-18(14)25)24-20(29)33-7-6-11-2-4-12(5-3-11)26(30)31/h2-5,9-10,13,15-16,19,27-28H,6-8H2,1H3,(H,21,22,24,29)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | VONXIKOZOSAOCK-NVQRDWNXSA-N |
| XLogP | 0.79 |
| TPSA | 183.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|