C13H9N3O2S2 — CID 34244500
4-[(3-nitrophenyl)methylsulfanyl]thieno[3,2-d]pyrimidine (PubChem CID 34244500) has the molecular formula C13H9N3O2S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-[(3-nitrophenyl)methylsulfanyl]thieno[3,2-d]pyrimidine.
| Compound Name | 4-[(3-nitrophenyl)methylsulfanyl]thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 34244500 |
| Molecular Formula | C13H9N3O2S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 4-[(3-nitrophenyl)methylsulfanyl]thieno[3,2-d]pyrimidine |
| SMILES | O=[N+]([O-])c1cccc(CSc2ncnc3ccsc23)c1 |
| InChI | InChI=1S/C13H9N3O2S2/c17-16(18)10-3-1-2-9(6-10)7-20-13-12-11(4-5-19-12)14-8-15-13/h1-6,8H,7H2 |
| InChIKey | DSBGLCLJQVHKKG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|