C11H11N3O2S2 — CID 24700555
4-methyl-5-[(3-nitrophenyl)methylsulfanyl]-1,3-thiazol-2-amine (PubChem CID 24700555) has the molecular formula C11H11N3O2S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-methyl-5-[(3-nitrophenyl)methylsulfanyl]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-5-[(3-nitrophenyl)methylsulfanyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 24700555 |
| Molecular Formula | C11H11N3O2S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 4-methyl-5-[(3-nitrophenyl)methylsulfanyl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1SCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N3O2S2/c1-7-10(18-11(12)13-7)17-6-8-3-2-4-9(5-8)14(15)16/h2-5H,6H2,1H3,(H2,12,13) |
| InChIKey | DWLNQDIQRCJVMB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|