C18H20N6O6 — CID 70869447
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(1S)-1-(4-nitrophenyl)ethoxy]methyl]oxolane-3,4-diol (PubChem CID 70869447) has the molecular formula C18H20N6O6 and a molecular weight of 416.39 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(1S)-1-(4-nitrophenyl)ethoxy]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(1S)-1-(4-nitrophenyl)ethoxy]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70869447 |
| Molecular Formula | C18H20N6O6 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[(1S)-1-(4-nitrophenyl)ethoxy]methyl]oxolane-3,4-diol |
| SMILES | C[C@H](OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20N6O6/c1-9(10-2-4-11(5-3-10)24(27)28)29-6-12-14(25)15(26)18(30-12)23-8-22-13-16(19)20-7-21-17(13)23/h2-5,7-9,12,14-15,18,25-26H,6H2,1H3,(H2,19,20,21)/t9-,12+,14+,15+,18+/m0/s1 |
| InChIKey | BLDNAJOBGNJRTN-YBGGAFRISA-N |
| XLogP | 0.71 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|