C20H25N5O6 — CID 70869416
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[1-(3,4-dimethoxyphenyl)ethoxymethyl]oxolane-3,4-diol (PubChem CID 70869416) has the molecular formula C20H25N5O6 and a molecular weight of 431.45 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[1-(3,4-dimethoxyphenyl)ethoxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[1-(3,4-dimethoxyphenyl)ethoxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70869416 |
| Molecular Formula | C20H25N5O6 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[1-(3,4-dimethoxyphenyl)ethoxymethyl]oxolane-3,4-diol |
| SMILES | COc1ccc(C(C)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)cc1OC |
| InChI | InChI=1S/C20H25N5O6/c1-10(11-4-5-12(28-2)13(6-11)29-3)30-7-14-16(26)17(27)20(31-14)25-9-24-15-18(21)22-8-23-19(15)25/h4-6,8-10,14,16-17,20,26-27H,7H2,1-3H3,(H2,21,22,23)/t10?,14-,16-,17-,20-/m1/s1 |
| InChIKey | WEGGPTCOEWTSOK-ZKFWECIDSA-N |
| XLogP | 0.82 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |