C18H17N5O5S — CID 171816821
(2R,3R,4S,5R)-2-[6-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 171816821) has the molecular formula C18H17N5O5S and a molecular weight of 415.43 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 171816821 |
| Molecular Formula | C18H17N5O5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methylsulfanyl]purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2cnc3c(SCc4cc(-c5ccco5)on4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H17N5O5S/c1-9-14(24)15(25)18(27-9)23-8-21-13-16(23)19-7-20-17(13)29-6-10-5-12(28-22-10)11-3-2-4-26-11/h2-5,7-9,14-15,18,24-25H,6H2,1H3/t9-,14-,15-,18-/m1/s1 |
| InChIKey | PMVRBWIDKZXMAM-POFSUORWSA-N |
| XLogP | 2.01 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |