C18H22N8O4P+ — CID 91551326
[3-hydroxy-5-[6-[2-[3-(1H-imidazol-5-yl)prop-2-enoylamino]ethylamino]purin-9-yl]oxolan-2-yl]methyl-oxo-tritiophosphanium (PubChem CID 91551326) has the molecular formula C18H22N8O4P+ and a molecular weight of 447.41 g/mol. Its IUPAC name is [3-hydroxy-5-[6-[2-[3-(1H-imidazol-5-yl)prop-2-enoylamino]ethylamino]purin-9-yl]oxolan-2-yl]methyl-oxo-tritiophosphanium.
| Compound Name | [3-hydroxy-5-[6-[2-[3-(1H-imidazol-5-yl)prop-2-enoylamino]ethylamino]purin-9-yl]oxolan-2-yl]methyl-oxo-tritiophosphanium |
|---|---|
| PubChem CID | 91551326 |
| Molecular Formula | C18H22N8O4P+ |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [3-hydroxy-5-[6-[2-[3-(1H-imidazol-5-yl)prop-2-enoylamino]ethylamino]purin-9-yl]oxolan-2-yl]methyl-oxo-tritiophosphanium |
| SMILES | [3H][P+](=O)CC1OC(n2cnc3c(NCCNC(=O)C=Cc4cnc[nH]4)ncnc32)CC1O |
| InChI | InChI=1S/C18H21N8O4P/c27-12-5-15(30-13(12)7-31-29)26-10-25-16-17(23-9-24-18(16)26)21-4-3-20-14(28)2-1-11-6-19-8-22-11/h1-2,6,8-10,12-13,15,27H,3-5,7H2,(H,19,22)(H,20,28)(H,21,23,24)/p+1/i/hT |
| InChIKey | SJRYGTNCVNQDBE-MNYXATJNSA-O |
| XLogP | 0.46 |
| TPSA | 159.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|