C21H31N8O4P — CID 59646319
N-[6-[[9-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]purin-6-yl]amino]hexyl]-2-(1H-imidazol-5-yl)acetamide (PubChem CID 59646319) has the molecular formula C21H31N8O4P and a molecular weight of 492.51 g/mol. Its IUPAC name is N-[6-[[9-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]purin-6-yl]amino]hexyl]-2-(1H-imidazol-5-yl)acetamide.
| Compound Name | N-[6-[[9-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]purin-6-yl]amino]hexyl]-2-(1H-imidazol-5-yl)acetamide |
|---|---|
| PubChem CID | 59646319 |
| Molecular Formula | C21H31N8O4P |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[6-[[9-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]purin-6-yl]amino]hexyl]-2-(1H-imidazol-5-yl)acetamide |
| SMILES | [3H]POCC1OC(n2cnc3c(NCCCCCCNC(=O)Cc4cnc[nH]4)ncnc32)CC1O |
| InChI | InChI=1S/C21H31N8O4P/c30-15-8-18(33-16(15)10-32-34)29-13-28-19-20(26-12-27-21(19)29)24-6-4-2-1-3-5-23-17(31)7-14-9-22-11-25-14/h9,11-13,15-16,18,30H,1-8,10,34H2,(H,22,25)(H,23,31)(H,24,26,27)/i34T |
| InChIKey | USAILJKHEAUECF-MAPKKUNKSA-N |
| XLogP | 1.34 |
| TPSA | 152.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|