C36H40N2O9 — CID 70141529
4-[1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(2-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]butyl acetate (PubChem CID 70141529) has the molecular formula C36H40N2O9 and a molecular weight of 644.72 g/mol. Its IUPAC name is 4-[1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(2-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]butyl acetate.
| Compound Name | 4-[1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(2-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]butyl acetate |
|---|---|
| PubChem CID | 70141529 |
| Molecular Formula | C36H40N2O9 |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | 4-[1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2,2-bis(2-methoxyphenyl)-2-phenylethyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]butyl acetate |
| SMILES | COc1ccccc1C(c1ccccc1)(c1ccccc1OC)C(O)[C@H]1O[C@@H](n2cc(CCCCOC(C)=O)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C36H40N2O9/c1-23(39)46-20-12-11-13-24-22-38(35(43)37-34(24)42)31-21-28(40)32(47-31)33(41)36(25-14-5-4-6-15-25,26-16-7-9-18-29(26)44-2)27-17-8-10-19-30(27)45-3/h4-10,14-19,22,28,31-33,40-41H,11-13,20-21H2,1-3H3,(H,37,42,43)/t28-,31+,32-,33?/m0/s1 |
| InChIKey | VVQIHXISUWLTHB-ZXJDZKJTSA-N |
| XLogP | 3.48 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|