C20H26N2O4 — CID 54180454
5-ethyl-1-[(2R,4S,5R)-4-hydroxy-5-(4-phenylbutyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 54180454) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-ethyl-1-[(2R,4S,5R)-4-hydroxy-5-(4-phenylbutyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-ethyl-1-[(2R,4S,5R)-4-hydroxy-5-(4-phenylbutyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54180454 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 5-ethyl-1-[(2R,4S,5R)-4-hydroxy-5-(4-phenylbutyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCc1cn([C@H]2C[C@H](O)[C@@H](CCCCc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H26N2O4/c1-2-15-13-22(20(25)21-19(15)24)18-12-16(23)17(26-18)11-7-6-10-14-8-4-3-5-9-14/h3-5,8-9,13,16-18,23H,2,6-7,10-12H2,1H3,(H,21,24,25)/t16-,17+,18+/m0/s1 |
| InChIKey | PBKHEEOCDRDDKB-RCCFBDPRSA-N |
| XLogP | 2.16 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|