C42H39ClN5O10P — CID 70123250
benzotriazol-1-yl (2-chlorophenyl) hydrogen phosphate;1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 70123250) has the molecular formula C42H39ClN5O10P and a molecular weight of 840.23 g/mol. Its IUPAC name is benzotriazol-1-yl (2-chlorophenyl) hydrogen phosphate;1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | benzotriazol-1-yl (2-chlorophenyl) hydrogen phosphate;1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70123250 |
| Molecular Formula | C42H39ClN5O10P |
| Molecular Weight | 840.23 g/mol |
| Exact Mass | 839.21 |
| IUPAC Name | benzotriazol-1-yl (2-chlorophenyl) hydrogen phosphate;1-[(2R,4S,5S)-4-hydroxy-5-[1-hydroxy-2-(4-methoxyphenyl)-2,2-diphenylethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccccc2)C(O)[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2O)cc1.O=P(O)(Oc1ccccc1Cl)On1nnc2ccccc21 |
| InChI | InChI=1S/C30H30N2O6.C12H9ClN3O4P/c1-19-18-32(29(36)31-28(19)35)25-17-24(33)26(38-25)27(34)30(20-9-5-3-6-10-20,21-11-7-4-8-12-21)22-13-15-23(37-2)16-14-22;13-9-5-1-4-8-12(9)19-21(17,18)20-16-11-7-3-2-6-10(11)14-15-16/h3-16,18,24-27,33-34H,17H2,1-2H3,(H,31,35,36);1-8H,(H,17,18)/t24-,25+,26-,27?;/m0./s1 |
| InChIKey | ZHEZLSODPDGIDN-UEABHLIKSA-N |
| XLogP | 5.59 |
| TPSA | 200.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.23 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|