C26H35N2O10P — CID 88889113
[(3R,4R,5R)-2-(2-diethoxyphosphorylprop-2-enyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate (PubChem CID 88889113) has the molecular formula C26H35N2O10P and a molecular weight of 566.54 g/mol. Its IUPAC name is [(3R,4R,5R)-2-(2-diethoxyphosphorylprop-2-enyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate.
| Compound Name | [(3R,4R,5R)-2-(2-diethoxyphosphorylprop-2-enyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 88889113 |
| Molecular Formula | C26H35N2O10P |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | [(3R,4R,5R)-2-(2-diethoxyphosphorylprop-2-enyl)-4-(2-methoxyethoxy)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] benzoate |
| SMILES | C=C(CC1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](OCCOC)[C@@H]1OC(=O)c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C26H35N2O10P/c1-6-35-39(32,36-7-2)18(4)15-20-21(38-25(30)19-11-9-8-10-12-19)22(34-14-13-33-5)24(37-20)28-16-17(3)23(29)27-26(28)31/h8-12,16,20-22,24H,4,6-7,13-15H2,1-3,5H3,(H,27,29,31)/t20?,21-,22-,24-/m1/s1 |
| InChIKey | QRBSVFGRTHRRMF-UIIWDNNXSA-N |
| XLogP | 3.17 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|