C14H24N3O7P — CID 11199760
diethyl [(3R,5S)-2-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,2-oxazolidin-3-yl]methyl phosphate (PubChem CID 11199760) has the molecular formula C14H24N3O7P and a molecular weight of 377.33 g/mol. Its IUPAC name is diethyl [(3R,5S)-2-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,2-oxazolidin-3-yl]methyl phosphate.
| Compound Name | diethyl [(3R,5S)-2-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,2-oxazolidin-3-yl]methyl phosphate |
|---|---|
| PubChem CID | 11199760 |
| Molecular Formula | C14H24N3O7P |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | diethyl [(3R,5S)-2-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,2-oxazolidin-3-yl]methyl phosphate |
| SMILES | CCOP(=O)(OCC)OC[C@H]1C[C@@H](n2cc(C)c(=O)[nH]c2=O)ON1C |
| InChI | InChI=1S/C14H24N3O7P/c1-5-21-25(20,22-6-2)23-9-11-7-12(24-16(11)4)17-8-10(3)13(18)15-14(17)19/h8,11-12H,5-7,9H2,1-4H3,(H,15,18,19)/t11-,12+/m1/s1 |
| InChIKey | UHILHPFOOCHWMX-NEPJUHHUSA-N |
| XLogP | 1.18 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|