C13H23N4O6P — CID 11337402
[(3R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-methyl-1,2-oxazolidin-3-yl]methyl diethyl phosphate (PubChem CID 11337402) has the molecular formula C13H23N4O6P and a molecular weight of 362.32 g/mol. Its IUPAC name is [(3R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-methyl-1,2-oxazolidin-3-yl]methyl diethyl phosphate.
| Compound Name | [(3R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-methyl-1,2-oxazolidin-3-yl]methyl diethyl phosphate |
|---|---|
| PubChem CID | 11337402 |
| Molecular Formula | C13H23N4O6P |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [(3R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-2-methyl-1,2-oxazolidin-3-yl]methyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC[C@H]1C[C@@H](n2ccc(N)nc2=O)ON1C |
| InChI | InChI=1S/C13H23N4O6P/c1-4-20-24(19,21-5-2)22-9-10-8-12(23-16(10)3)17-7-6-11(14)15-13(17)18/h6-7,10,12H,4-5,8-9H2,1-3H3,(H2,14,15,18)/t10-,12+/m1/s1 |
| InChIKey | XJINBQMKLNCRAK-PWSUYJOCSA-N |
| XLogP | 1.16 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|