C16H26FN2O6P — CID 90687616
1-[5-(2-diethoxyphosphorylethyl)-3-fluoro-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 90687616) has the molecular formula C16H26FN2O6P and a molecular weight of 392.36 g/mol. Its IUPAC name is 1-[5-(2-diethoxyphosphorylethyl)-3-fluoro-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[5-(2-diethoxyphosphorylethyl)-3-fluoro-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90687616 |
| Molecular Formula | C16H26FN2O6P |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[5-(2-diethoxyphosphorylethyl)-3-fluoro-4-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(CCC1OC(n2cc(C)c(=O)[nH]c2=O)C(F)C1C)OCC |
| InChI | InChI=1S/C16H26FN2O6P/c1-5-23-26(22,24-6-2)8-7-12-11(4)13(17)15(25-12)19-9-10(3)14(20)18-16(19)21/h9,11-13,15H,5-8H2,1-4H3,(H,18,20,21) |
| InChIKey | SXEXLYUSNYSJBM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|