C11H13FN2O4 — CID 174114387
(2S,3R,4S,5R)-4-fluoro-3-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde (PubChem CID 174114387) has the molecular formula C11H13FN2O4 and a molecular weight of 256.23 g/mol. Its IUPAC name is (2S,3R,4S,5R)-4-fluoro-3-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde.
| Compound Name | (2S,3R,4S,5R)-4-fluoro-3-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 174114387 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (2S,3R,4S,5R)-4-fluoro-3-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde |
| SMILES | Cc1cn([C@@H]2O[C@H](C=O)[C@@H](C)[C@@H]2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H13FN2O4/c1-5-3-14(11(17)13-9(5)16)10-8(12)6(2)7(4-15)18-10/h3-4,6-8,10H,1-2H3,(H,13,16,17)/t6-,7-,8+,10-/m1/s1 |
| InChIKey | CACOVBUDJWWALW-BDNRQGISSA-N |
| XLogP | -0.08 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|