C33H34N5O10P — CID 159315379
benzyl 1-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]cyclopentane-1-carboxylate (PubChem CID 159315379) has the molecular formula C33H34N5O10P and a molecular weight of 691.63 g/mol. Its IUPAC name is benzyl 1-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]cyclopentane-1-carboxylate.
| Compound Name | benzyl 1-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 159315379 |
| Molecular Formula | C33H34N5O10P |
| Molecular Weight | 691.63 g/mol |
| Exact Mass | 691.20 |
| IUPAC Name | benzyl 1-[[[(2R,3S,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-3,4-dihydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]cyclopentane-1-carboxylate |
| SMILES | [N-]=[N+]=N[C@]1(COP(=O)(NC2(C(=O)OCc3ccccc3)CCCC2)Oc2cccc3ccccc23)O[C@@H](N2C=CC(=O)CC2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C33H34N5O10P/c34-37-35-33(29(42)28(41)30(47-33)38-18-15-24(39)19-27(38)40)21-46-49(44,48-26-14-8-12-23-11-4-5-13-25(23)26)36-32(16-6-7-17-32)31(43)45-20-22-9-2-1-3-10-22/h1-5,8-15,18,28-30,41-42H,6-7,16-17,19-21H2,(H,36,44)/t28-,29+,30-,33-,49?/m1/s1 |
| InChIKey | LDBKEHYLFQLYDY-HPEAULHSSA-N |
| XLogP | 4.39 |
| TPSA | 209.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|