C28H31FN5O9P — CID 159235434
cyclopentyl (2S)-2-[[[(2R,3R,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 159235434) has the molecular formula C28H31FN5O9P and a molecular weight of 631.55 g/mol. Its IUPAC name is cyclopentyl (2S)-2-[[[(2R,3R,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | cyclopentyl (2S)-2-[[[(2R,3R,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 159235434 |
| Molecular Formula | C28H31FN5O9P |
| Molecular Weight | 631.55 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | cyclopentyl (2S)-2-[[[(2R,3R,4R,5R)-2-azido-5-(2,4-dioxo-1-pyridinyl)-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](N2C=CC(=O)CC2=O)[C@H](F)[C@@H]1O)Oc1cccc2ccccc12)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C28H31FN5O9P/c1-17(27(38)41-20-9-3-4-10-20)31-44(39,43-22-12-6-8-18-7-2-5-11-21(18)22)40-16-28(32-33-30)25(37)24(29)26(42-28)34-14-13-19(35)15-23(34)36/h2,5-8,11-14,17,20,24-26,37H,3-4,9-10,15-16H2,1H3,(H,31,39)/t17-,24+,25-,26+,28+,44?/m0/s1 |
| InChIKey | KTKJGCGKYAGHIK-BCUACBKDSA-N |
| XLogP | 4.18 |
| TPSA | 189.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|