C24H32FN3O10P+ — CID 163966274
propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-3-ium-1-yl)-2-fluoro-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 163966274) has the molecular formula C24H32FN3O10P+ and a molecular weight of 572.50 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-3-ium-1-yl)-2-fluoro-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-3-ium-1-yl)-2-fluoro-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163966274 |
| Molecular Formula | C24H32FN3O10P+ |
| Molecular Weight | 572.50 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | propan-2-yl 2-[[[5-(2,4-dioxopyrimidin-3-ium-1-yl)-2-fluoro-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C(C)C1(O)C(N2C=CC(=O)[NH2+]C2=O)OC(F)(COP(=O)(NC(C)C(=O)OC(C)C)Oc2ccccc2)C1O |
| InChI | InChI=1S/C24H31FN3O10P/c1-14(2)24(33)20(31)23(25,37-21(24)28-12-11-18(29)26-22(28)32)13-35-39(34,38-17-9-7-6-8-10-17)27-16(5)19(30)36-15(3)4/h6-12,15-16,20-21,31,33H,1,13H2,2-5H3,(H,27,34)(H,26,29,32)/p+1 |
| InChIKey | SMBHEKCAHXJTGT-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 177.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.50 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|