C19H24FN4O9P — CID 90343659
2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 90343659) has the molecular formula C19H24FN4O9P and a molecular weight of 502.39 g/mol. Its IUPAC name is 2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | 2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 90343659 |
| Molecular Formula | C19H24FN4O9P |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-5-[4-(hydroxyamino)-2-oxopyrimidin-1-yl]-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | CC(NP(=O)(OC[C@H]1O[C@@H](n2ccc(NO)nc2=O)[C@](C)(F)[C@@H]1O)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H24FN4O9P/c1-11(16(26)27)23-34(30,33-12-6-4-3-5-7-12)31-10-13-15(25)19(2,20)17(32-13)24-9-8-14(22-29)21-18(24)28/h3-9,11,13,15,17,25,29H,10H2,1-2H3,(H,23,30)(H,26,27)(H,21,22,28)/t11?,13-,15-,17-,19-,34?/m1/s1 |
| InChIKey | PGXZRJUJGLOAAI-XQUCRDBFSA-N |
| XLogP | 1.30 |
| TPSA | 181.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|