C23H29N4O9P — CID 161217889
propan-2-yl (2S)-3-[[[(2R,3S,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]-dideuteriomethoxy]-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 161217889) has the molecular formula C23H29N4O9P and a molecular weight of 538.49 g/mol. Its IUPAC name is propan-2-yl (2S)-3-[[[(2R,3S,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]-dideuteriomethoxy]-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | propan-2-yl (2S)-3-[[[(2R,3S,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]-dideuteriomethoxy]-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 161217889 |
| Molecular Formula | C23H29N4O9P |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | propan-2-yl (2S)-3-[[[(2R,3S,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]-dideuteriomethoxy]-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | [2H]C([2H])(O[P@@](=O)(C[C@@H](C)C(=O)OC(C)C)Oc1ccccc1)[C@H]1O[C@@H](n2ncc(N)nc2=O)C(O)(C#C)[C@H]1O |
| InChI | InChI=1S/C23H29N4O9P/c1-5-23(31)19(28)17(35-21(23)27-22(30)26-18(24)11-25-27)12-33-37(32,36-16-9-7-6-8-10-16)13-15(4)20(29)34-14(2)3/h1,6-11,14-15,17,19,21,28,31H,12-13H2,2-4H3,(H2,24,26,30)/t15-,17-,19+,21-,23?,37+/m1/s1/i12D2 |
| InChIKey | AFRUDPYZTHJVDQ-JKMXNGFUSA-N |
| XLogP | 0.72 |
| TPSA | 185.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|