C23H27ClN3O9P — CID 157132678
propan-2-yl (2S)-3-[[[(2R,3S,5R)-4-chloro-5-(2,4-dioxo-1,3,5-triazin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]-dideuteriomethoxy]-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 157132678) has the molecular formula C23H27ClN3O9P and a molecular weight of 557.92 g/mol. Its IUPAC name is propan-2-yl (2S)-3-[[[(2R,3S,5R)-4-chloro-5-(2,4-dioxo-1,3,5-triazin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]-dideuteriomethoxy]-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | propan-2-yl (2S)-3-[[[(2R,3S,5R)-4-chloro-5-(2,4-dioxo-1,3,5-triazin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]-dideuteriomethoxy]-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 157132678 |
| Molecular Formula | C23H27ClN3O9P |
| Molecular Weight | 557.92 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | propan-2-yl (2S)-3-[[[(2R,3S,5R)-4-chloro-5-(2,4-dioxo-1,3,5-triazin-1-yl)-4-ethynyl-3-hydroxyoxolan-2-yl]-dideuteriomethoxy]-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | [2H]C([2H])(O[P@@](=O)(C[C@@H](C)C(=O)OC(C)C)Oc1ccccc1)[C@H]1O[C@@H](n2cnc(=O)[nH]c2=O)C(Cl)(C#C)[C@H]1O |
| InChI | InChI=1S/C23H27ClN3O9P/c1-5-23(24)18(28)17(35-20(23)27-13-25-21(30)26-22(27)31)11-33-37(32,36-16-9-7-6-8-10-16)12-15(4)19(29)34-14(2)3/h1,6-10,13-15,17-18,20,28H,11-12H2,2-4H3,(H,26,30,31)/t15-,17-,18+,20-,23?,37+/m1/s1/i11D2 |
| InChIKey | XWHIPCLYAAQFDD-YQLHZSGISA-N |
| XLogP | 1.68 |
| TPSA | 159.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.92 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|