C14H15FN5O13P3 — CID 138702574
[[(2S,3S,4R,5R)-5-(4-amino-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 138702574) has the molecular formula C14H15FN5O13P3 and a molecular weight of 573.22 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(4-amino-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(4-amino-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 138702574 |
| Molecular Formula | C14H15FN5O13P3 |
| Molecular Weight | 573.22 g/mol |
| Exact Mass | 572.99 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(4-amino-5-cyanopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-2-fluoro-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(O)[C@H](n2cc(C#N)c3c(N)ncnc32)O[C@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C14H15FN5O13P3/c1-2-13(22)11(21)14(15,5-30-35(26,27)33-36(28,29)32-34(23,24)25)31-12(13)20-4-7(3-16)8-9(17)18-6-19-10(8)20/h1,4,6,11-12,21-22H,5H2,(H,26,27)(H,28,29)(H2,17,18,19)(H2,23,24,25)/t11-,12+,13+,14+/m0/s1 |
| InChIKey | WWOALHHJEKXZGT-REWJHTLYSA-N |
| XLogP | -0.85 |
| TPSA | 290.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|