C14H19N4O12P3 — CID 123855611
[[5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123855611) has the molecular formula C14H19N4O12P3 and a molecular weight of 528.24 g/mol. Its IUPAC name is [[5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123855611 |
| Molecular Formula | C14H19N4O12P3 |
| Molecular Weight | 528.24 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | [[5-(4-amino-5-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC(n2cc(C)c3c(N)ncnc32)CC1O |
| InChI | InChI=1S/C14H19N4O12P3/c1-3-14(6-27-32(23,24)30-33(25,26)29-31(20,21)22)9(19)4-10(28-14)18-5-8(2)11-12(15)16-7-17-13(11)18/h1,5,7,9-10,19H,4,6H2,2H3,(H,23,24)(H,25,26)(H2,15,16,17)(H2,20,21,22) |
| InChIKey | VPIVGEISISSVHR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 246.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|