C20H28N5O16P3 — CID 59336639
ethyl 2-[5-[4-amino-7-[4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-ynoylamino]oxyacetate (PubChem CID 59336639) has the molecular formula C20H28N5O16P3 and a molecular weight of 687.38 g/mol. Its IUPAC name is ethyl 2-[5-[4-amino-7-[4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-ynoylamino]oxyacetate.
| Compound Name | ethyl 2-[5-[4-amino-7-[4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-ynoylamino]oxyacetate |
|---|---|
| PubChem CID | 59336639 |
| Molecular Formula | C20H28N5O16P3 |
| Molecular Weight | 687.38 g/mol |
| Exact Mass | 687.07 |
| IUPAC Name | ethyl 2-[5-[4-amino-7-[4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]pent-4-ynoylamino]oxyacetate |
| SMILES | CCOC(=O)CONC(=O)CCC#Cc1cn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c2ncnc(N)c12 |
| InChI | InChI=1S/C20H28N5O16P3/c1-2-36-17(28)10-37-24-15(27)6-4-3-5-12-8-25(20-18(12)19(21)22-11-23-20)16-7-13(26)14(39-16)9-38-43(32,33)41-44(34,35)40-42(29,30)31/h8,11,13-14,16,26H,2,4,6-7,9-10H2,1H3,(H,24,27)(H,32,33)(H,34,35)(H2,21,22,23)(H2,29,30,31) |
| InChIKey | MDBMIUOJESVDBL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 310.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.38 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|