C23H31N2O16P3 — CID 159514210
ethyl 2-[6-[4-amino-1-[4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]indol-3-yl]-2-oxohex-5-ynoxy]acetate (PubChem CID 159514210) has the molecular formula C23H31N2O16P3 and a molecular weight of 684.42 g/mol. Its IUPAC name is ethyl 2-[6-[4-amino-1-[4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]indol-3-yl]-2-oxohex-5-ynoxy]acetate.
| Compound Name | ethyl 2-[6-[4-amino-1-[4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]indol-3-yl]-2-oxohex-5-ynoxy]acetate |
|---|---|
| PubChem CID | 159514210 |
| Molecular Formula | C23H31N2O16P3 |
| Molecular Weight | 684.42 g/mol |
| Exact Mass | 684.09 |
| IUPAC Name | ethyl 2-[6-[4-amino-1-[4-hydroxy-5-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]oxolan-2-yl]indol-3-yl]-2-oxohex-5-ynoxy]acetate |
| SMILES | CCOC(=O)COCC(=O)CCC#Cc1cn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c2cccc(N)c12 |
| InChI | InChI=1S/C23H31N2O16P3/c1-2-37-22(28)14-36-12-16(26)7-4-3-6-15-11-25(18-9-5-8-17(24)23(15)18)21-10-19(27)20(39-21)13-38-43(32,33)41-44(34,35)40-42(29,30)31/h5,8-9,11,19-21,27H,2,4,7,10,12-14,24H2,1H3,(H,32,33)(H,34,35)(H2,29,30,31) |
| InChIKey | MAYXIKNGYLFSEJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 272.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|