C9H14F2N3O14P3 — CID 129280935
[[(2R,5R)-4-fluoro-5-(6-fluoro-3,5-dioxo-1,2,4-triazin-2-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 129280935) has the molecular formula C9H14F2N3O14P3 and a molecular weight of 519.14 g/mol. Its IUPAC name is [[(2R,5R)-4-fluoro-5-(6-fluoro-3,5-dioxo-1,2,4-triazin-2-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-4-fluoro-5-(6-fluoro-3,5-dioxo-1,2,4-triazin-2-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 129280935 |
| Molecular Formula | C9H14F2N3O14P3 |
| Molecular Weight | 519.14 g/mol |
| Exact Mass | 518.97 |
| IUPAC Name | [[(2R,5R)-4-fluoro-5-(6-fluoro-3,5-dioxo-1,2,4-triazin-2-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1(F)C(O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1nc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H14F2N3O14P3/c1-9(11)4(15)3(26-7(9)14-8(17)12-6(16)5(10)13-14)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3-4,7,15H,2H2,1H3,(H,21,22)(H,23,24)(H,12,16,17)(H2,18,19,20)/t3-,4?,7-,9?/m1/s1 |
| InChIKey | MCBIOCZYGXMHFQ-AITGULPVSA-N |
| XLogP | -1.60 |
| TPSA | 257.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.14 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|