C11H17ClFN6O12P3 — CID 137482252
[[(2S,3S,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-2-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 137482252) has the molecular formula C11H17ClFN6O12P3 and a molecular weight of 572.66 g/mol. Its IUPAC name is [[(2S,3S,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-2-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-2-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 137482252 |
| Molecular Formula | C11H17ClFN6O12P3 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 571.98 |
| IUPAC Name | [[(2S,3S,4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-2-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CNc1nc(N)nc2c1ncn2[C@@H]1O[C@](Cl)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C11H17ClFN6O12P3/c1-15-7-5-8(18-10(14)17-7)19(3-16-5)9-4(13)6(20)11(12,29-9)2-28-33(24,25)31-34(26,27)30-32(21,22)23/h3-4,6,9,20H,2H2,1H3,(H,24,25)(H,26,27)(H2,21,22,23)(H3,14,15,17,18)/t4-,6-,9+,11+/m0/s1 |
| InChIKey | WCVOQWZYEJZGLR-RYNVUYHKSA-N |
| XLogP | -0.04 |
| TPSA | 270.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|