C12H18ClN7O11P2 — CID 90477870
[(2R,3S,4R,5R)-5-[2-amino-6-[2-(2-chloroacetyl)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 90477870) has the molecular formula C12H18ClN7O11P2 and a molecular weight of 533.72 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-amino-6-[2-(2-chloroacetyl)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[2-amino-6-[2-(2-chloroacetyl)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90477870 |
| Molecular Formula | C12H18ClN7O11P2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.02 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-amino-6-[2-(2-chloroacetyl)hydrazinyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | Nc1nc(NNC(=O)CCl)c2ncn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C12H18ClN7O11P2/c13-1-5(21)18-19-9-6-10(17-12(14)16-9)20(3-15-6)11-8(23)7(22)4(30-11)2-29-33(27,28)31-32(24,25)26/h3-4,7-8,11,22-23H,1-2H2,(H,18,21)(H,27,28)(H2,24,25,26)(H3,14,16,17,19)/t4-,7-,8-,11-/m1/s1 |
| InChIKey | NSAANTYOCNCSNH-TZQXKBMNSA-N |
| XLogP | -2.06 |
| TPSA | 273.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|