C12H14N5O4PS — CID 156688498
[(1R,3R,7S)-3-(6-aminopurin-9-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-oxo-sulfidophosphanium (PubChem CID 156688498) has the molecular formula C12H14N5O4PS and a molecular weight of 355.32 g/mol. Its IUPAC name is [(1R,3R,7S)-3-(6-aminopurin-9-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-oxo-sulfidophosphanium.
| Compound Name | [(1R,3R,7S)-3-(6-aminopurin-9-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-oxo-sulfidophosphanium |
|---|---|
| PubChem CID | 156688498 |
| Molecular Formula | C12H14N5O4PS |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | [(1R,3R,7S)-3-(6-aminopurin-9-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-oxo-sulfidophosphanium |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@]2(CO[P+](=O)[S-])CCC1[C@@H]2O |
| InChI | InChI=1S/C12H14N5O4PS/c13-9-7-10(15-4-14-9)17(5-16-7)11-6-1-2-12(21-11,8(6)18)3-20-22(19)23/h4-6,8,11,18H,1-3H2,(H2,13,14,15)/t6?,8-,11+,12+/m0/s1 |
| InChIKey | AWMISUSCYGWZCU-PBBGIMLGSA-N |
| XLogP | 0.67 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|