C12H15N5O4P+ — CID 160733149
[(1R,3R,4R)-3-(6-aminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium (PubChem CID 160733149) has the molecular formula C12H15N5O4P+ and a molecular weight of 324.26 g/mol. Its IUPAC name is [(1R,3R,4R)-3-(6-aminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium.
| Compound Name | [(1R,3R,4R)-3-(6-aminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 160733149 |
| Molecular Formula | C12H15N5O4P+ |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [(1R,3R,4R)-3-(6-aminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium |
| SMILES | C[P+](=O)OC[C@]12CO[C@H](C1)[C@H](n1cnc3c(N)ncnc31)O2 |
| InChI | InChI=1S/C12H15N5O4P/c1-22(18)20-4-12-2-7(19-3-12)11(21-12)17-6-16-8-9(13)14-5-15-10(8)17/h5-7,11H,2-4H2,1H3,(H2,13,14,15)/q+1/t7-,11-,12-/m1/s1 |
| InChIKey | LKIRZYQOVYIDDG-NZXMKCKXSA-N |
| XLogP | 0.85 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|