C12H17N5O3S — CID 163539936
(2R,3S)-2-(6-aminopurin-9-yl)-4-(2-methylsulfanylethyl)oxolane-3,4-diol (PubChem CID 163539936) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is (2R,3S)-2-(6-aminopurin-9-yl)-4-(2-methylsulfanylethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S)-2-(6-aminopurin-9-yl)-4-(2-methylsulfanylethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 163539936 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2R,3S)-2-(6-aminopurin-9-yl)-4-(2-methylsulfanylethyl)oxolane-3,4-diol |
| SMILES | CSCCC1(O)CO[C@@H](n2cnc3c(N)ncnc32)[C@H]1O |
| InChI | InChI=1S/C12H17N5O3S/c1-21-3-2-12(19)4-20-11(8(12)18)17-6-16-7-9(13)14-5-15-10(7)17/h5-6,8,11,18-19H,2-4H2,1H3,(H2,13,14,15)/t8-,11-,12?/m1/s1 |
| InChIKey | FAGAHJNJDHCKLF-LYFNNULSSA-N |
| XLogP | -0.22 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |