C12H13N5O4 — CID 155408927
(1S,2S)-7-(6-aminopurin-9-yl)-8-oxatricyclo[3.3.0.01,4]octane-2,5,6-triol (PubChem CID 155408927) has the molecular formula C12H13N5O4 and a molecular weight of 291.27 g/mol. Its IUPAC name is (1S,2S)-7-(6-aminopurin-9-yl)-8-oxatricyclo[3.3.0.01,4]octane-2,5,6-triol.
| Compound Name | (1S,2S)-7-(6-aminopurin-9-yl)-8-oxatricyclo[3.3.0.01,4]octane-2,5,6-triol |
|---|---|
| PubChem CID | 155408927 |
| Molecular Formula | C12H13N5O4 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (1S,2S)-7-(6-aminopurin-9-yl)-8-oxatricyclo[3.3.0.01,4]octane-2,5,6-triol |
| SMILES | Nc1ncnc2c1ncn2C1O[C@@]23C(C[C@@H]2O)C3(O)C1O |
| InChI | InChI=1S/C12H13N5O4/c13-8-6-9(15-2-14-8)17(3-16-6)10-7(19)11(20)4-1-5(18)12(4,11)21-10/h2-5,7,10,18-20H,1H2,(H2,13,14,15)/t4?,5-,7?,10?,11?,12-/m0/s1 |
| InChIKey | GOLNWBFRHPRXOO-NXHXHDKZSA-N |
| XLogP | -1.84 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |