C11H17O11P — CID 67611960
[(2S,3S,4R,5R)-2,3,4-triacetyloxy-5-(hydroxymethyl)oxolan-2-yl]phosphonic acid (PubChem CID 67611960) has the molecular formula C11H17O11P and a molecular weight of 356.22 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-2,3,4-triacetyloxy-5-(hydroxymethyl)oxolan-2-yl]phosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-2,3,4-triacetyloxy-5-(hydroxymethyl)oxolan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 67611960 |
| Molecular Formula | C11H17O11P |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | [(2S,3S,4R,5R)-2,3,4-triacetyloxy-5-(hydroxymethyl)oxolan-2-yl]phosphonic acid |
| SMILES | CC(=O)O[C@@H]1[C@@H](CO)O[C@@](OC(C)=O)(P(=O)(O)O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H17O11P/c1-5(13)19-9-8(4-12)22-11(21-7(3)15,23(16,17)18)10(9)20-6(2)14/h8-10,12H,4H2,1-3H3,(H2,16,17,18)/t8-,9-,10+,11-/m1/s1 |
| InChIKey | BCJTZUUREXXHDD-CHWFTXMASA-N |
| XLogP | -1.36 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|