C17H26N2O11 — CID 21140345
[(2R,3R,4S,5R)-4,5,6-triacetyloxy-5-(dimethylcarbamoylamino)-2-(hydroxymethyl)oxan-3-yl] acetate (PubChem CID 21140345) has the molecular formula C17H26N2O11 and a molecular weight of 434.40 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4,5,6-triacetyloxy-5-(dimethylcarbamoylamino)-2-(hydroxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-4,5,6-triacetyloxy-5-(dimethylcarbamoylamino)-2-(hydroxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 21140345 |
| Molecular Formula | C17H26N2O11 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | [(2R,3R,4S,5R)-4,5,6-triacetyloxy-5-(dimethylcarbamoylamino)-2-(hydroxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](CO)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@]1(NC(=O)N(C)C)OC(C)=O |
| InChI | InChI=1S/C17H26N2O11/c1-8(21)26-13-12(7-20)29-15(28-10(3)23)17(30-11(4)24,14(13)27-9(2)22)18-16(25)19(5)6/h12-15,20H,7H2,1-6H3,(H,18,25)/t12-,13-,14+,15?,17-/m1/s1 |
| InChIKey | PUOHMJGVJNIVHT-JPHNIFDFSA-N |
| XLogP | -1.34 |
| TPSA | 167.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|