C13H19BrO8 — CID 139686852
[(2R,3R,4S,5R)-6-bromo-4,5-bis[(2-deuterioacetyl)oxy]-2-(hydroxymethyl)-6-methyloxan-3-yl] 2-deuterioacetate (PubChem CID 139686852) has the molecular formula C13H19BrO8 and a molecular weight of 386.21 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-bromo-4,5-bis[(2-deuterioacetyl)oxy]-2-(hydroxymethyl)-6-methyloxan-3-yl] 2-deuterioacetate.
| Compound Name | [(2R,3R,4S,5R)-6-bromo-4,5-bis[(2-deuterioacetyl)oxy]-2-(hydroxymethyl)-6-methyloxan-3-yl] 2-deuterioacetate |
|---|---|
| PubChem CID | 139686852 |
| Molecular Formula | C13H19BrO8 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | [(2R,3R,4S,5R)-6-bromo-4,5-bis[(2-deuterioacetyl)oxy]-2-(hydroxymethyl)-6-methyloxan-3-yl] 2-deuterioacetate |
| SMILES | [2H]CC(=O)O[C@H]1[C@H](OC(=O)C[2H])[C@@H](CO)OC(C)(Br)[C@@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C13H19BrO8/c1-6(16)19-10-9(5-15)22-13(4,14)12(21-8(3)18)11(10)20-7(2)17/h9-12,15H,5H2,1-4H3/t9-,10-,11+,12-,13?/m1/s1/i1D,2D,3D |
| InChIKey | QHLUCLARRSHSHC-AHPLALMQSA-N |
| XLogP | 0.28 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|