C14H21ClO10 — CID 141209353
[(2R,3R,4S,5R)-4,5,6-tris[(2-deuterioacetyl)oxy]-2-(hydroxymethyl)oxan-3-yl] 2-deuterioacetate;hydrochloride (PubChem CID 141209353) has the molecular formula C14H21ClO10 and a molecular weight of 388.79 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4,5,6-tris[(2-deuterioacetyl)oxy]-2-(hydroxymethyl)oxan-3-yl] 2-deuterioacetate;hydrochloride.
| Compound Name | [(2R,3R,4S,5R)-4,5,6-tris[(2-deuterioacetyl)oxy]-2-(hydroxymethyl)oxan-3-yl] 2-deuterioacetate;hydrochloride |
|---|---|
| PubChem CID | 141209353 |
| Molecular Formula | C14H21ClO10 |
| Molecular Weight | 388.79 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [(2R,3R,4S,5R)-4,5,6-tris[(2-deuterioacetyl)oxy]-2-(hydroxymethyl)oxan-3-yl] 2-deuterioacetate;hydrochloride |
| SMILES | Cl.[2H]CC(=O)OC1O[C@H](CO)[C@@H](OC(=O)C[2H])[C@H](OC(=O)C[2H])[C@H]1OC(=O)C[2H] |
| InChI | InChI=1S/C14H20O10.ClH/c1-6(16)20-11-10(5-15)24-14(23-9(4)19)13(22-8(3)18)12(11)21-7(2)17;/h10-15H,5H2,1-4H3;1H/t10-,11-,12+,13-,14?;/m1./s1/i1D,2D,3D,4D; |
| InChIKey | ZUWMXJAGHVIYPV-NRYCISRVSA-N |
| XLogP | -0.52 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.79 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|