C21H38N8O4 — CID 11554518
(1S,2R,3R,4S,6R)-4,6-diamino-3-[3-[1-[5-[4-(3-hydroxypropyl)triazol-1-yl]pentyl]triazol-4-yl]propoxy]cyclohexane-1,2-diol (PubChem CID 11554518) has the molecular formula C21H38N8O4 and a molecular weight of 466.59 g/mol. Its IUPAC name is (1S,2R,3R,4S,6R)-4,6-diamino-3-[3-[1-[5-[4-(3-hydroxypropyl)triazol-1-yl]pentyl]triazol-4-yl]propoxy]cyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4S,6R)-4,6-diamino-3-[3-[1-[5-[4-(3-hydroxypropyl)triazol-1-yl]pentyl]triazol-4-yl]propoxy]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 11554518 |
| Molecular Formula | C21H38N8O4 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | (1S,2R,3R,4S,6R)-4,6-diamino-3-[3-[1-[5-[4-(3-hydroxypropyl)triazol-1-yl]pentyl]triazol-4-yl]propoxy]cyclohexane-1,2-diol |
| SMILES | N[C@@H]1C[C@H](N)[C@@H](OCCCc2cn(CCCCCn3cc(CCCO)nn3)nn2)[C@H](O)C1O |
| InChI | InChI=1S/C21H38N8O4/c22-17-12-18(23)21(20(32)19(17)31)33-11-5-7-16-14-29(27-25-16)9-3-1-2-8-28-13-15(24-26-28)6-4-10-30/h13-14,17-21,30-32H,1-12,22-23H2/t17-,18+,19?,20-,21-/m1/s1 |
| InChIKey | LGNMJVOJBCKXMC-BFSSTPSDSA-N |
| XLogP | -1.24 |
| TPSA | 183.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|