C17H32N4O4 — CID 46929382
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(4-propyltriazol-1-yl)hexyl]piperidine-3,4,5-triol (PubChem CID 46929382) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(4-propyltriazol-1-yl)hexyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(4-propyltriazol-1-yl)hexyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 46929382 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(4-propyltriazol-1-yl)hexyl]piperidine-3,4,5-triol |
| SMILES | CCCc1cn(CCCCCCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)nn1 |
| InChI | InChI=1S/C17H32N4O4/c1-2-7-13-10-21(19-18-13)9-6-4-3-5-8-20-11-15(23)17(25)16(24)14(20)12-22/h10,14-17,22-25H,2-9,11-12H2,1H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | KYJOEMPBTWRCMH-YYIAUSFCSA-N |
| XLogP | -0.45 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|