C30H52N4O5 — CID 54589897
(2R,3R,4R,5S)-1-[10-[4-(1-adamantylmethoxymethyl)triazol-1-yl]decyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 54589897) has the molecular formula C30H52N4O5 and a molecular weight of 548.77 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[10-[4-(1-adamantylmethoxymethyl)triazol-1-yl]decyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[10-[4-(1-adamantylmethoxymethyl)triazol-1-yl]decyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 54589897 |
| Molecular Formula | C30H52N4O5 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | (2R,3R,4R,5S)-1-[10-[4-(1-adamantylmethoxymethyl)triazol-1-yl]decyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCCCCCCCn1cc(COCC23CC4CC(CC(C4)C2)C3)nn1 |
| InChI | InChI=1S/C30H52N4O5/c35-19-26-28(37)29(38)27(36)18-33(26)9-7-5-3-1-2-4-6-8-10-34-17-25(31-32-34)20-39-21-30-14-22-11-23(15-30)13-24(12-22)16-30/h17,22-24,26-29,35-38H,1-16,18-21H2/t22?,23?,24?,26-,27+,28-,29-,30?/m1/s1 |
| InChIKey | DUXBGDVYIQLMGX-QSQLTXGKSA-N |
| XLogP | 2.89 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|