C28H48N4O5 — CID 54589896
(2R,3R,4R,5S)-1-[8-[4-(1-adamantylmethoxymethyl)triazol-1-yl]octyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 54589896) has the molecular formula C28H48N4O5 and a molecular weight of 520.72 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[8-[4-(1-adamantylmethoxymethyl)triazol-1-yl]octyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[8-[4-(1-adamantylmethoxymethyl)triazol-1-yl]octyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 54589896 |
| Molecular Formula | C28H48N4O5 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | (2R,3R,4R,5S)-1-[8-[4-(1-adamantylmethoxymethyl)triazol-1-yl]octyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCCCCCn1cc(COCC23CC4CC(CC(C4)C2)C3)nn1 |
| InChI | InChI=1S/C28H48N4O5/c33-17-24-26(35)27(36)25(34)16-31(24)7-5-3-1-2-4-6-8-32-15-23(29-30-32)18-37-19-28-12-20-9-21(13-28)11-22(10-20)14-28/h15,20-22,24-27,33-36H,1-14,16-19H2/t20?,21?,22?,24-,25+,26-,27-,28?/m1/s1 |
| InChIKey | OGAHBWBWPUWLKS-NLTICPCISA-N |
| XLogP | 2.11 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|