C20H32N4O4 — CID 54589810
(2R,3R,4R,5S)-1-[[1-(1-adamantylmethyl)triazol-4-yl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 54589810) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[[1-(1-adamantylmethyl)triazol-4-yl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[[1-(1-adamantylmethyl)triazol-4-yl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 54589810 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (2R,3R,4R,5S)-1-[[1-(1-adamantylmethyl)triazol-4-yl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1Cc1cn(CC23CC4CC(CC(C4)C2)C3)nn1 |
| InChI | InChI=1S/C20H32N4O4/c25-10-16-18(27)19(28)17(26)9-23(16)7-15-8-24(22-21-15)11-20-4-12-1-13(5-20)3-14(2-12)6-20/h8,12-14,16-19,25-28H,1-7,9-11H2/t12?,13?,14?,16-,17+,18-,19-,20?/m1/s1 |
| InChIKey | MSOUCBBDNBJRTC-RCJNMEOKSA-N |
| XLogP | -0.25 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |