C16H30N4O6 — CID 52937816
(1R,2S,4R,5S)-6-[[1-(7-hydroxyheptyl)triazol-4-yl]methylamino]cyclohexane-1,2,3,4,5-pentol (PubChem CID 52937816) has the molecular formula C16H30N4O6 and a molecular weight of 374.44 g/mol. Its IUPAC name is (1R,2S,4R,5S)-6-[[1-(7-hydroxyheptyl)triazol-4-yl]methylamino]cyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1R,2S,4R,5S)-6-[[1-(7-hydroxyheptyl)triazol-4-yl]methylamino]cyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 52937816 |
| Molecular Formula | C16H30N4O6 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (1R,2S,4R,5S)-6-[[1-(7-hydroxyheptyl)triazol-4-yl]methylamino]cyclohexane-1,2,3,4,5-pentol |
| SMILES | OCCCCCCCn1cc(CNC2[C@@H](O)[C@H](O)C(O)[C@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C16H30N4O6/c21-7-5-3-1-2-4-6-20-9-10(18-19-20)8-17-11-12(22)14(24)16(26)15(25)13(11)23/h9,11-17,21-26H,1-8H2/t11?,12-,13+,14+,15-,16? |
| InChIKey | BDSNJLULQHPZHE-GRPLBRPNSA-N |
| XLogP | -2.50 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|