C47H60N4O6 — CID 52937003
(1R,2R,3S,4R,5R,6S)-2-[[1-(10-hydroxydecyl)triazol-4-yl]methylamino]-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol (PubChem CID 52937003) has the molecular formula C47H60N4O6 and a molecular weight of 777.02 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R,6S)-2-[[1-(10-hydroxydecyl)triazol-4-yl]methylamino]-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2R,3S,4R,5R,6S)-2-[[1-(10-hydroxydecyl)triazol-4-yl]methylamino]-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 52937003 |
| Molecular Formula | C47H60N4O6 |
| Molecular Weight | 777.02 g/mol |
| Exact Mass | 776.45 |
| IUPAC Name | (1R,2R,3S,4R,5R,6S)-2-[[1-(10-hydroxydecyl)triazol-4-yl]methylamino]-3,4,5,6-tetrakis(phenylmethoxy)cyclohexan-1-ol |
| SMILES | OCCCCCCCCCCn1cc(CN[C@@H]2[C@@H](O)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)nn1 |
| InChI | InChI=1S/C47H60N4O6/c52-30-20-6-4-2-1-3-5-19-29-51-32-41(49-50-51)31-48-42-43(53)45(55-34-38-23-13-8-14-24-38)47(57-36-40-27-17-10-18-28-40)46(56-35-39-25-15-9-16-26-39)44(42)54-33-37-21-11-7-12-22-37/h7-18,21-28,32,42-48,52-53H,1-6,19-20,29-31,33-36H2/t42-,43-,44+,45+,46-,47-/m1/s1 |
| InChIKey | KAGDROFULSESLC-VRIPJMLGSA-N |
| XLogP | 7.57 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.02 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|