C30H56N10O6 — CID 11628869
(1S,2R,3R,4S,6R)-4,6-diamino-3-[4-[1-[6-[4-[4-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxybutyl]triazol-1-yl]hexyl]triazol-4-yl]butoxy]cyclohexane-1,2-diol (PubChem CID 11628869) has the molecular formula C30H56N10O6 and a molecular weight of 652.84 g/mol. Its IUPAC name is (1S,2R,3R,4S,6R)-4,6-diamino-3-[4-[1-[6-[4-[4-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxybutyl]triazol-1-yl]hexyl]triazol-4-yl]butoxy]cyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4S,6R)-4,6-diamino-3-[4-[1-[6-[4-[4-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxybutyl]triazol-1-yl]hexyl]triazol-4-yl]butoxy]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 11628869 |
| Molecular Formula | C30H56N10O6 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.44 |
| IUPAC Name | (1S,2R,3R,4S,6R)-4,6-diamino-3-[4-[1-[6-[4-[4-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxybutyl]triazol-1-yl]hexyl]triazol-4-yl]butoxy]cyclohexane-1,2-diol |
| SMILES | N[C@@H]1C[C@H](N)[C@@H](OCCCCc2cn(CCCCCCn3cc(CCCCO[C@H]4[C@H](O)[C@@H](O)[C@H](N)C[C@@H]4N)nn3)nn2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C30H56N10O6/c31-21-15-23(33)29(27(43)25(21)41)45-13-7-3-9-19-17-39(37-35-19)11-5-1-2-6-12-40-18-20(36-38-40)10-4-8-14-46-30-24(34)16-22(32)26(42)28(30)44/h17-18,21-30,41-44H,1-16,31-34H2/t21-,22-,23+,24+,25+,26+,27-,28-,29-,30-/m1/s1 |
| InChIKey | UMBRLBMJFIIVOS-NQXIBGIKSA-N |
| XLogP | -1.89 |
| TPSA | 264.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|