C28H47N3O8 — CID 11541291
[(2S,3S,4R,5R,6R)-4,5-diacetyloxy-2-methyl-6-[6-(4-octyltriazol-1-yl)hexoxy]oxan-3-yl] acetate (PubChem CID 11541291) has the molecular formula C28H47N3O8 and a molecular weight of 553.70 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-2-methyl-6-[6-(4-octyltriazol-1-yl)hexoxy]oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-2-methyl-6-[6-(4-octyltriazol-1-yl)hexoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 11541291 |
| Molecular Formula | C28H47N3O8 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-2-methyl-6-[6-(4-octyltriazol-1-yl)hexoxy]oxan-3-yl] acetate |
| SMILES | CCCCCCCCc1cn(CCCCCCO[C@@H]2O[C@@H](C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)nn1 |
| InChI | InChI=1S/C28H47N3O8/c1-6-7-8-9-10-13-16-24-19-31(30-29-24)17-14-11-12-15-18-35-28-27(39-23(5)34)26(38-22(4)33)25(20(2)36-28)37-21(3)32/h19-20,25-28H,6-18H2,1-5H3/t20-,25-,26+,27+,28+/m0/s1 |
| InChIKey | CUCQECMXSDCBHX-MAOLKGKKSA-N |
| XLogP | 4.30 |
| TPSA | 128.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|