C27H43N3O13 — CID 155602449
[(3R,4S,6R)-4,5-diacetyloxy-6-[(Z)-4-[[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]but-2-enoxy]-2-methyloxan-3-yl] acetate (PubChem CID 155602449) has the molecular formula C27H43N3O13 and a molecular weight of 617.65 g/mol. Its IUPAC name is [(3R,4S,6R)-4,5-diacetyloxy-6-[(Z)-4-[[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]but-2-enoxy]-2-methyloxan-3-yl] acetate.
| Compound Name | [(3R,4S,6R)-4,5-diacetyloxy-6-[(Z)-4-[[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]but-2-enoxy]-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 155602449 |
| Molecular Formula | C27H43N3O13 |
| Molecular Weight | 617.65 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | [(3R,4S,6R)-4,5-diacetyloxy-6-[(Z)-4-[[1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]but-2-enoxy]-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@H](OC/C=C\COCc2cn(CCOCCOCCOCCO)nn2)OC(C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H43N3O13/c1-19-24(41-20(2)32)25(42-21(3)33)26(43-22(4)34)27(40-19)39-10-6-5-9-38-18-23-17-30(29-28-23)7-11-35-13-15-37-16-14-36-12-8-31/h5-6,17,19,24-27,31H,7-16,18H2,1-4H3/b6-5-/t19?,24-,25+,26?,27-/m1/s1 |
| InChIKey | QERTYDWYIAKOLE-LUGIEHPTSA-N |
| XLogP | -0.05 |
| TPSA | 185.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.65 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|