C30H34N8O9 — CID 102277496
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-[2-(4-pyridin-2-yltriazol-1-yl)ethoxy]-2-[2-(4-pyridin-2-yltriazol-1-yl)ethoxymethyl]oxan-3-yl] acetate (PubChem CID 102277496) has the molecular formula C30H34N8O9 and a molecular weight of 650.65 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-[2-(4-pyridin-2-yltriazol-1-yl)ethoxy]-2-[2-(4-pyridin-2-yltriazol-1-yl)ethoxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-[2-(4-pyridin-2-yltriazol-1-yl)ethoxy]-2-[2-(4-pyridin-2-yltriazol-1-yl)ethoxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 102277496 |
| Molecular Formula | C30H34N8O9 |
| Molecular Weight | 650.65 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-6-[2-(4-pyridin-2-yltriazol-1-yl)ethoxy]-2-[2-(4-pyridin-2-yltriazol-1-yl)ethoxymethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OCCn2cc(-c3ccccn3)nn2)O[C@H](COCCn2cc(-c3ccccn3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H34N8O9/c1-19(39)44-27-26(18-42-14-12-37-16-24(33-35-37)22-8-4-6-10-31-22)47-30(29(46-21(3)41)28(27)45-20(2)40)43-15-13-38-17-25(34-36-38)23-9-5-7-11-32-23/h4-11,16-17,26-30H,12-15,18H2,1-3H3/t26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | XWSKXBIDOGTATP-CMPUJJQDSA-N |
| XLogP | 1.25 |
| TPSA | 193.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.65 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|